C38H41N7O5 — CID 161328049
N-benzyl-4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]-methylamino]benzamide (PubChem CID 161328049) has the molecular formula C38H41N7O5 and a molecular weight of 675.79 g/mol. Its IUPAC name is N-benzyl-4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]-methylamino]benzamide.
| Compound Name | N-benzyl-4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]-methylamino]benzamide |
|---|---|
| PubChem CID | 161328049 |
| Molecular Formula | C38H41N7O5 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | N-benzyl-4-[[4-(4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]-methylamino]benzamide |
| SMILES | CN(c1ccc(C(=O)NCc2ccccc2)cc1)c1nc(NCCOCCOCCCC(=O)c2ccccc2)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C38H41N7O5/c1-45(32-18-14-30(15-19-32)35(48)40-27-28-9-4-2-5-10-28)38-43-36(42-37(44-38)41-31-16-20-33(46)21-17-31)39-22-24-50-26-25-49-23-8-13-34(47)29-11-6-3-7-12-29/h2-7,9-12,14-21,46H,8,13,22-27H2,1H3,(H,40,48)(H2,39,41,42,43,44) |
| InChIKey | VLAPYMNFDGWZIY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|