C37H37F2N7O5 — CID 152997766
4-[[4-(3-fluoro-4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 152997766) has the molecular formula C37H37F2N7O5 and a molecular weight of 697.74 g/mol. Its IUPAC name is 4-[[4-(3-fluoro-4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[[4-(3-fluoro-4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 152997766 |
| Molecular Formula | C37H37F2N7O5 |
| Molecular Weight | 697.74 g/mol |
| Exact Mass | 697.28 |
| IUPAC Name | 4-[[4-(3-fluoro-4-hydroxyanilino)-6-[2-[2-(4-oxo-4-phenylbutoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(CCCOCCOCCNc1nc(Nc2ccc(C(=O)NCc3ccc(F)cc3)cc2)nc(Nc2ccc(O)c(F)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C37H37F2N7O5/c38-28-12-8-25(9-13-28)24-41-34(49)27-10-14-29(15-11-27)42-36-44-35(45-37(46-36)43-30-16-17-33(48)31(39)23-30)40-18-20-51-22-21-50-19-4-7-32(47)26-5-2-1-3-6-26/h1-3,5-6,8-17,23,48H,4,7,18-22,24H2,(H,41,49)(H3,40,42,43,44,45,46) |
| InChIKey | UXOGDHGNUDMWPV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|