C34H38FN7O7 — CID 157218790
methyl 5-[[4-[4-[(4-fluorophenyl)methylcarbamoyl]anilino]-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate (PubChem CID 157218790) has the molecular formula C34H38FN7O7 and a molecular weight of 675.72 g/mol. Its IUPAC name is methyl 5-[[4-[4-[(4-fluorophenyl)methylcarbamoyl]anilino]-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 5-[[4-[4-[(4-fluorophenyl)methylcarbamoyl]anilino]-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 157218790 |
| Molecular Formula | C34H38FN7O7 |
| Molecular Weight | 675.72 g/mol |
| Exact Mass | 675.28 |
| IUPAC Name | methyl 5-[[4-[4-[(4-fluorophenyl)methylcarbamoyl]anilino]-6-[2-[2-(4-oxopentoxy)ethoxy]ethylamino]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(Nc2nc(NCCOCCOCCCC(C)=O)nc(Nc3ccc(C(=O)NCc4ccc(F)cc4)cc3)n2)ccc1O |
| InChI | InChI=1S/C34H38FN7O7/c1-22(43)4-3-16-48-18-19-49-17-15-36-32-40-33(42-34(41-32)39-27-13-14-29(44)28(20-27)31(46)47-2)38-26-11-7-24(8-12-26)30(45)37-21-23-5-9-25(35)10-6-23/h5-14,20,44H,3-4,15-19,21H2,1-2H3,(H,37,45)(H3,36,38,39,40,41,42) |
| InChIKey | XPMAEBXOUJBFSF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|