C30H34N6O5 — CID 147833631
4-[2-[2-[[4-anilino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]-1-(3-methoxyphenyl)butan-1-one (PubChem CID 147833631) has the molecular formula C30H34N6O5 and a molecular weight of 558.64 g/mol. Its IUPAC name is 4-[2-[2-[[4-anilino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]-1-(3-methoxyphenyl)butan-1-one.
| Compound Name | 4-[2-[2-[[4-anilino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]-1-(3-methoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 147833631 |
| Molecular Formula | C30H34N6O5 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 4-[2-[2-[[4-anilino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]-1-(3-methoxyphenyl)butan-1-one |
| SMILES | COc1cccc(C(=O)CCCOCCOCCNc2nc(Nc3ccccc3)nc(Nc3ccc(O)cc3)n2)c1 |
| InChI | InChI=1S/C30H34N6O5/c1-39-26-10-5-7-22(21-26)27(38)11-6-17-40-19-20-41-18-16-31-28-34-29(32-23-8-3-2-4-9-23)36-30(35-28)33-24-12-14-25(37)15-13-24/h2-5,7-10,12-15,21,37H,6,11,16-20H2,1H3,(H3,31,32,33,34,35,36) |
| InChIKey | HROTUTQQVPGHIK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|