C28H37N7O4 — CID 23758345
N-[2-[2-[2-[[4-(3-methoxyanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23758345) has the molecular formula C28H37N7O4 and a molecular weight of 535.65 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-(3-methoxyanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-(3-methoxyanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23758345 |
| Molecular Formula | C28H37N7O4 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | N-[2-[2-[2-[[4-(3-methoxyanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | COc1cccc(Nc2nc(NCCOCCOCCNC(=O)c3ccccc3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C28H37N7O4/c1-37-24-12-8-11-23(21-24)31-27-32-26(33-28(34-27)35-15-6-3-7-16-35)30-14-18-39-20-19-38-17-13-29-25(36)22-9-4-2-5-10-22/h2,4-5,8-12,21H,3,6-7,13-20H2,1H3,(H,29,36)(H2,30,31,32,33,34) |
| InChIKey | MMZCEIFEHKPIGI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|