C32H47N7O4 — CID 23928989
N-[2-[2-[2-[[4-[(4-methoxyphenyl)methylamino]-6-(octylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23928989) has the molecular formula C32H47N7O4 and a molecular weight of 593.77 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-[(4-methoxyphenyl)methylamino]-6-(octylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-[(4-methoxyphenyl)methylamino]-6-(octylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23928989 |
| Molecular Formula | C32H47N7O4 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.37 |
| IUPAC Name | N-[2-[2-[2-[[4-[(4-methoxyphenyl)methylamino]-6-(octylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CCCCCCCCNc1nc(NCCOCCOCCNC(=O)c2ccccc2)nc(NCc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C32H47N7O4/c1-3-4-5-6-7-11-18-34-30-37-31(39-32(38-30)36-25-26-14-16-28(41-2)17-15-26)35-20-22-43-24-23-42-21-19-33-29(40)27-12-9-8-10-13-27/h8-10,12-17H,3-7,11,18-25H2,1-2H3,(H,33,40)(H3,34,35,36,37,38,39) |
| InChIKey | WKROXPLIIAIKJV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|