C28H39N7O3 — CID 23758382
N-[2-[2-[2-[[4-(benzylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23758382) has the molecular formula C28H39N7O3 and a molecular weight of 521.67 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-(benzylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-(benzylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23758382 |
| Molecular Formula | C28H39N7O3 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | N-[2-[2-[2-[[4-(benzylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CCC(CC)Nc1nc(NCCOCCOCCNC(=O)c2ccccc2)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C28H39N7O3/c1-3-24(4-2)32-28-34-26(33-27(35-28)31-21-22-11-7-5-8-12-22)30-16-18-38-20-19-37-17-15-29-25(36)23-13-9-6-10-14-23/h5-14,24H,3-4,15-21H2,1-2H3,(H,29,36)(H3,30,31,32,33,34,35) |
| InChIKey | LJCAPTYIQINRCC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|