C24H37N7O4 — CID 23787473
N-[2-[2-[2-[[4-(butan-2-ylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23787473) has the molecular formula C24H37N7O4 and a molecular weight of 487.61 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-(butan-2-ylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-(butan-2-ylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23787473 |
| Molecular Formula | C24H37N7O4 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-[2-[2-[2-[[4-(butan-2-ylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CCC(C)Nc1nc(NCCOCCOCCNC(=O)c2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H37N7O4/c1-3-19(2)27-23-28-22(29-24(30-23)31-11-15-35-16-12-31)26-10-14-34-18-17-33-13-9-25-21(32)20-7-5-4-6-8-20/h4-8,19H,3,9-18H2,1-2H3,(H,25,32)(H2,26,27,28,29,30) |
| InChIKey | ZYUCQXJHFNTRJK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|