C17H18Cl3N5O3 — CID 110178173
2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl benzoate (PubChem CID 110178173) has the molecular formula C17H18Cl3N5O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is 2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl benzoate.
| Compound Name | 2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl benzoate |
|---|---|
| PubChem CID | 110178173 |
| Molecular Formula | C17H18Cl3N5O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl benzoate |
| SMILES | O=C(OCCNc1nc(N2CCOCC2)nc(C(Cl)(Cl)Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C17H18Cl3N5O3/c18-17(19,20)14-22-15(24-16(23-14)25-7-10-27-11-8-25)21-6-9-28-13(26)12-4-2-1-3-5-12/h1-5H,6-11H2,(H,21,22,23,24) |
| InChIKey | PUTCWQZIWUVRGZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|