C14H16Cl3N5O5 — CID 110178175
(E)-4-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethoxy]-4-oxobut-2-enoic acid (PubChem CID 110178175) has the molecular formula C14H16Cl3N5O5 and a molecular weight of 440.67 g/mol. Its IUPAC name is (E)-4-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 110178175 |
| Molecular Formula | C14H16Cl3N5O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | (E)-4-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OCCNc1nc(N2CCOCC2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C14H16Cl3N5O5/c15-14(16,17)11-19-12(18-3-6-27-10(25)2-1-9(23)24)21-13(20-11)22-4-7-26-8-5-22/h1-2H,3-8H2,(H,23,24)(H,18,19,20,21)/b2-1+ |
| InChIKey | XUIGRESUGBDENV-OWOJBTEDSA-N |
| XLogP | 1.13 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|