C10H15Cl3N6O2 — CID 110178484
2-[[4-(morpholin-4-ylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 110178484) has the molecular formula C10H15Cl3N6O2 and a molecular weight of 357.63 g/mol. Its IUPAC name is 2-[[4-(morpholin-4-ylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(morpholin-4-ylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 110178484 |
| Molecular Formula | C10H15Cl3N6O2 |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-[[4-(morpholin-4-ylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(NN2CCOCC2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C10H15Cl3N6O2/c11-10(12,13)7-15-8(14-1-4-20)17-9(16-7)18-19-2-5-21-6-3-19/h20H,1-6H2,(H2,14,15,16,17,18) |
| InChIKey | POSASKYIUGTWFH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|