C19H29N7O2 — CID 117093688
2-[[4-(diethylamino)-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 117093688) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(diethylamino)-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 117093688 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-[[4-(diethylamino)-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCN(CC)c1nc(NCCO)nc(Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C19H29N7O2/c1-3-25(4-2)19-23-17(20-9-12-27)22-18(24-19)21-15-5-7-16(8-6-15)26-10-13-28-14-11-26/h5-8,27H,3-4,9-14H2,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | WXTRYWYNCSRYAK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|