C16H22N6O2 — CID 117093416
4-N-(1,3-benzodioxol-5-yl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 117093416) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117093416 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-2-N,2-N,6-N-triethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(Nc2ccc3c(c2)OCO3)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C16H22N6O2/c1-4-17-14-19-15(21-16(20-14)22(5-2)6-3)18-11-7-8-12-13(9-11)24-10-23-12/h7-9H,4-6,10H2,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | AYHRGWWPPFTVLC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |