C17H22N4O2 — CID 112901347
4-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112901347) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112901347 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1nccc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-3-9-21(10-4-2)17-18-8-7-16(20-17)19-13-5-6-14-15(11-13)23-12-22-14/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,18,19,20) |
| InChIKey | CSYJTJGAMVLROK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |