C16H20Cl2N4 — CID 112901361
4-N-(2,6-dichlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112901361) has the molecular formula C16H20Cl2N4 and a molecular weight of 339.27 g/mol. Its IUPAC name is 4-N-(2,6-dichlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,6-dichlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112901361 |
| Molecular Formula | C16H20Cl2N4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-N-(2,6-dichlorophenyl)-2-N,2-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1nccc(Nc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C16H20Cl2N4/c1-3-10-22(11-4-2)16-19-9-8-14(21-16)20-15-12(17)6-5-7-13(15)18/h5-9H,3-4,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | WRRTVPSNMFRFIK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |