C13H14Cl2N4 — CID 80754827
4-N-(2,3-dichlorophenyl)-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80754827) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 4-N-(2,3-dichlorophenyl)-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3-dichlorophenyl)-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80754827 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-N-(2,3-dichlorophenyl)-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nccc(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C13H14Cl2N4/c1-2-7-16-13-17-8-6-11(19-13)18-10-5-3-4-9(14)12(10)15/h3-6,8H,2,7H2,1H3,(H2,16,17,18,19) |
| InChIKey | NSQLSHPHCOSRNP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |