C15H18Cl2N4 — CID 112900546
4-N-(2,3-dichlorophenyl)-2-N-pentylpyrimidine-2,4-diamine (PubChem CID 112900546) has the molecular formula C15H18Cl2N4 and a molecular weight of 325.24 g/mol. Its IUPAC name is 4-N-(2,3-dichlorophenyl)-2-N-pentylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3-dichlorophenyl)-2-N-pentylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112900546 |
| Molecular Formula | C15H18Cl2N4 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-N-(2,3-dichlorophenyl)-2-N-pentylpyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nccc(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C15H18Cl2N4/c1-2-3-4-9-18-15-19-10-8-13(21-15)20-12-7-5-6-11(16)14(12)17/h5-8,10H,2-4,9H2,1H3,(H2,18,19,20,21) |
| InChIKey | OJFLCDZHCRFEND-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|