C14H17Cl2N5 — CID 112960009
5-N-(2,3-dichlorophenyl)-3-N-pentyl-1,2,4-triazine-3,5-diamine (PubChem CID 112960009) has the molecular formula C14H17Cl2N5 and a molecular weight of 326.23 g/mol. Its IUPAC name is 5-N-(2,3-dichlorophenyl)-3-N-pentyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,3-dichlorophenyl)-3-N-pentyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112960009 |
| Molecular Formula | C14H17Cl2N5 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-N-(2,3-dichlorophenyl)-3-N-pentyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCCNc1nncc(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C14H17Cl2N5/c1-2-3-4-8-17-14-20-12(9-18-21-14)19-11-7-5-6-10(15)13(11)16/h5-7,9H,2-4,8H2,1H3,(H2,17,19,20,21) |
| InChIKey | CGBNXLWYZYAZJF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|