C11H21N5 — CID 112938570
5-N-pentyl-3-N-propyl-1,2,4-triazine-3,5-diamine (PubChem CID 112938570) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 5-N-pentyl-3-N-propyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-pentyl-3-N-propyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112938570 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 5-N-pentyl-3-N-propyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCCNc1cnnc(NCCC)n1 |
| InChI | InChI=1S/C11H21N5/c1-3-5-6-8-12-10-9-14-16-11(15-10)13-7-4-2/h9H,3-8H2,1-2H3,(H2,12,13,15,16) |
| InChIKey | RTYLMFUPDKPRCR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|