C9H15N5 — CID 112938292
3-N-prop-2-enyl-5-N-propyl-1,2,4-triazine-3,5-diamine (PubChem CID 112938292) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-N-prop-2-enyl-5-N-propyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-prop-2-enyl-5-N-propyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112938292 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-N-prop-2-enyl-5-N-propyl-1,2,4-triazine-3,5-diamine |
| SMILES | C=CCNc1nncc(NCCC)n1 |
| InChI | InChI=1S/C9H15N5/c1-3-5-10-8-7-12-14-9(13-8)11-6-4-2/h4,7H,2-3,5-6H2,1H3,(H2,10,11,13,14) |
| InChIKey | WDEZVSNXPQIEFX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|