C16H21N5 — CID 112939591
3-N-(4-tert-butylphenyl)-5-N-prop-2-enyl-1,2,4-triazine-3,5-diamine (PubChem CID 112939591) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-N-(4-tert-butylphenyl)-5-N-prop-2-enyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(4-tert-butylphenyl)-5-N-prop-2-enyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112939591 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-N-(4-tert-butylphenyl)-5-N-prop-2-enyl-1,2,4-triazine-3,5-diamine |
| SMILES | C=CCNc1cnnc(Nc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C16H21N5/c1-5-10-17-14-11-18-21-15(20-14)19-13-8-6-12(7-9-13)16(2,3)4/h5-9,11H,1,10H2,2-4H3,(H2,17,19,20,21) |
| InChIKey | MUZOOICXNAHFEZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|