C15H19N5 — CID 112939783
3-N-prop-2-enyl-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112939783) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-N-prop-2-enyl-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-prop-2-enyl-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112939783 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3-N-prop-2-enyl-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | C=CCNc1nncc(Nc2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C15H19N5/c1-5-6-16-15-19-13(9-17-20-15)18-14-11(3)7-10(2)8-12(14)4/h5,7-9H,1,6H2,2-4H3,(H2,16,18,19,20) |
| InChIKey | VBBHAAJTMUIDEP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|