C14H16ClN5O2 — CID 112939860
5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-prop-2-enyl-1,2,4-triazine-3,5-diamine (PubChem CID 112939860) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-prop-2-enyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-prop-2-enyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112939860 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-prop-2-enyl-1,2,4-triazine-3,5-diamine |
| SMILES | C=CCNc1nncc(Nc2cc(OC)c(Cl)cc2OC)n1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-4-5-16-14-19-13(8-17-20-14)18-10-7-11(21-2)9(15)6-12(10)22-3/h4,6-8H,1,5H2,2-3H3,(H2,16,18,19,20) |
| InChIKey | PZLUCUKHIKPDJV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|