C19H24ClN5O2 — CID 112943101
3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112943101) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943101 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1cc(Nc2nncc(NCCC3=CCCCC3)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H24ClN5O2/c1-26-16-11-15(17(27-2)10-14(16)20)23-19-24-18(12-22-25-19)21-9-8-13-6-4-3-5-7-13/h6,10-12H,3-5,7-9H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | RCZAKMSPLHPSOA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|