C16H23ClN6O2 — CID 112945582
3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112945582) has the molecular formula C16H23ClN6O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112945582 |
| Molecular Formula | C16H23ClN6O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-N-(4-chloro-2,5-dimethoxyphenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1cc(Nc2nncc(NCCCN(C)C)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C16H23ClN6O2/c1-23(2)7-5-6-18-15-10-19-22-16(21-15)20-12-9-13(24-3)11(17)8-14(12)25-4/h8-10H,5-7H2,1-4H3,(H2,18,20,21,22) |
| InChIKey | QAPIUWVKXNSYNV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|