C14H18F2N6 — CID 112945570
3-N-(2,4-difluorophenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112945570) has the molecular formula C14H18F2N6 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-N-(2,4-difluorophenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,4-difluorophenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112945570 |
| Molecular Formula | C14H18F2N6 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-N-(2,4-difluorophenyl)-5-N-[3-(dimethylamino)propyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)CCCNc1cnnc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C14H18F2N6/c1-22(2)7-3-6-17-13-9-18-21-14(20-13)19-12-5-4-10(15)8-11(12)16/h4-5,8-9H,3,6-7H2,1-2H3,(H2,17,19,20,21) |
| InChIKey | SYKHTDVGELVJOH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|