C15H21FN6 — CID 112945429
5-N-[3-(dimethylamino)propyl]-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112945429) has the molecular formula C15H21FN6 and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-N-[3-(dimethylamino)propyl]-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[3-(dimethylamino)propyl]-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112945429 |
| Molecular Formula | C15H21FN6 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 5-N-[3-(dimethylamino)propyl]-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)CCCNc1cnnc(NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H21FN6/c1-22(2)9-3-8-17-14-11-19-21-15(20-14)18-10-12-4-6-13(16)7-5-12/h4-7,11H,3,8-10H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | IVIJUHNJLHCMNJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|