C13H18N6 — CID 112939909
5-N-butyl-3-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112939909) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 5-N-butyl-3-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-butyl-3-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112939909 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 5-N-butyl-3-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCNc1cnnc(NCc2ccncc2)n1 |
| InChI | InChI=1S/C13H18N6/c1-2-3-6-15-12-10-17-19-13(18-12)16-9-11-4-7-14-8-5-11/h4-5,7-8,10H,2-3,6,9H2,1H3,(H2,15,16,18,19) |
| InChIKey | CTDVWPWFTOOUIC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|