C15H20FN5 — CID 112949746
3-N-[(2-fluorophenyl)methyl]-5-N-pentyl-1,2,4-triazine-3,5-diamine (PubChem CID 112949746) has the molecular formula C15H20FN5 and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-N-[(2-fluorophenyl)methyl]-5-N-pentyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[(2-fluorophenyl)methyl]-5-N-pentyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112949746 |
| Molecular Formula | C15H20FN5 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-N-[(2-fluorophenyl)methyl]-5-N-pentyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCCNc1cnnc(NCc2ccccc2F)n1 |
| InChI | InChI=1S/C15H20FN5/c1-2-3-6-9-17-14-11-19-21-15(20-14)18-10-12-7-4-5-8-13(12)16/h4-5,7-8,11H,2-3,6,9-10H2,1H3,(H2,17,18,20,21) |
| InChIKey | LHBKMEOMOMTGED-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|