C12H14N6 — CID 112939713
3-N-prop-2-enyl-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112939713) has the molecular formula C12H14N6 and a molecular weight of 242.29 g/mol. Its IUPAC name is 3-N-prop-2-enyl-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-prop-2-enyl-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112939713 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-N-prop-2-enyl-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | C=CCNc1nncc(NCc2ccncc2)n1 |
| InChI | InChI=1S/C12H14N6/c1-2-5-14-12-17-11(9-16-18-12)15-8-10-3-6-13-7-4-10/h2-4,6-7,9H,1,5,8H2,(H2,14,15,17,18) |
| InChIKey | RKMYFHMNMYOVAG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|