C17H22N6 — CID 112943141
3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112943141) has the molecular formula C17H22N6 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943141 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-(pyridin-4-ylmethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | C1=C(CCNc2nncc(NCc3ccncc3)n2)CCCC1 |
| InChI | InChI=1S/C17H22N6/c1-2-4-14(5-3-1)8-11-19-17-22-16(13-21-23-17)20-12-15-6-9-18-10-7-15/h4,6-7,9-10,13H,1-3,5,8,11-12H2,(H2,19,20,22,23) |
| InChIKey | PPSRHOIFNZBURE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|