C17H20ClN5 — CID 112943216
5-N-(4-chlorophenyl)-3-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112943216) has the molecular formula C17H20ClN5 and a molecular weight of 329.83 g/mol. Its IUPAC name is 5-N-(4-chlorophenyl)-3-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(4-chlorophenyl)-3-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943216 |
| Molecular Formula | C17H20ClN5 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5-N-(4-chlorophenyl)-3-N-[2-(cyclohexen-1-yl)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | Clc1ccc(Nc2cnnc(NCCC3=CCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H20ClN5/c18-14-6-8-15(9-7-14)21-16-12-20-23-17(22-16)19-11-10-13-4-2-1-3-5-13/h4,6-9,12H,1-3,5,10-11H2,(H2,19,21,22,23) |
| InChIKey | ARHCZVBBBXUUTQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|