C20H26N4 — CID 112885606
2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(4-ethylphenyl)pyrimidine-2,4-diamine (PubChem CID 112885606) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(4-ethylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(4-ethylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112885606 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(4-ethylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCc1ccc(Nc2ccnc(NCCC3=CCCCC3)n2)cc1 |
| InChI | InChI=1S/C20H26N4/c1-2-16-8-10-18(11-9-16)23-19-13-15-22-20(24-19)21-14-12-17-6-4-3-5-7-17/h6,8-11,13,15H,2-5,7,12,14H2,1H3,(H2,21,22,23,24) |
| InChIKey | YZAJGSQAODPFOS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|