C19H23BrN4 — CID 112885613
4-N-(3-bromo-4-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112885613) has the molecular formula C19H23BrN4 and a molecular weight of 387.33 g/mol. Its IUPAC name is 4-N-(3-bromo-4-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-bromo-4-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112885613 |
| Molecular Formula | C19H23BrN4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 4-N-(3-bromo-4-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2ccnc(NCCC3=CCCCC3)n2)cc1Br |
| InChI | InChI=1S/C19H23BrN4/c1-14-7-8-16(13-17(14)20)23-18-10-12-22-19(24-18)21-11-9-15-5-3-2-4-6-15/h5,7-8,10,12-13H,2-4,6,9,11H2,1H3,(H2,21,22,23,24) |
| InChIKey | MHCXXZMCKDDEIJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|