C20H25N5O2 — CID 112943267
ethyl 4-[[3-[2-(cyclohexen-1-yl)ethylamino]-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112943267) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 4-[[3-[2-(cyclohexen-1-yl)ethylamino]-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | ethyl 4-[[3-[2-(cyclohexen-1-yl)ethylamino]-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112943267 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | ethyl 4-[[3-[2-(cyclohexen-1-yl)ethylamino]-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cnnc(NCCC3=CCCCC3)n2)cc1 |
| InChI | InChI=1S/C20H25N5O2/c1-2-27-19(26)16-8-10-17(11-9-16)23-18-14-22-25-20(24-18)21-13-12-15-6-4-3-5-7-15/h6,8-11,14H,2-5,7,12-13H2,1H3,(H2,21,23,24,25) |
| InChIKey | IKMVUKAQLVZRKV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|