C16H21N5O2 — CID 112959106
ethyl 4-[[3-(tert-butylamino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112959106) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is ethyl 4-[[3-(tert-butylamino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(tert-butylamino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112959106 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | ethyl 4-[[3-(tert-butylamino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cnnc(NC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C16H21N5O2/c1-5-23-14(22)11-6-8-12(9-7-11)18-13-10-17-21-15(19-13)20-16(2,3)4/h6-10H,5H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | ODUWOCGKKGDSOP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |