C18H18N6O2 — CID 112952603
ethyl 4-[[5-(pyridin-4-ylmethylamino)-1,2,4-triazin-3-yl]amino]benzoate (PubChem CID 112952603) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is ethyl 4-[[5-(pyridin-4-ylmethylamino)-1,2,4-triazin-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(pyridin-4-ylmethylamino)-1,2,4-triazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 112952603 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl 4-[[5-(pyridin-4-ylmethylamino)-1,2,4-triazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nncc(NCc3ccncc3)n2)cc1 |
| InChI | InChI=1S/C18H18N6O2/c1-2-26-17(25)14-3-5-15(6-4-14)22-18-23-16(12-21-24-18)20-11-13-7-9-19-10-8-13/h3-10,12H,2,11H2,1H3,(H2,20,22,23,24) |
| InChIKey | XFAWUOYMGYGMID-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |