C15H19N5O2 — CID 112939059
ethyl 4-[[3-(propan-2-ylamino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112939059) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is ethyl 4-[[3-(propan-2-ylamino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(propan-2-ylamino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112939059 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | ethyl 4-[[3-(propan-2-ylamino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cnnc(NC(C)C)n2)cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-4-22-14(21)11-5-7-12(8-6-11)18-13-9-16-20-15(19-13)17-10(2)3/h5-10H,4H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | TVQSLNZMAQEGSS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |