C15H19N5O3 — CID 112943452
ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]benzoate (PubChem CID 112943452) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 112943452 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nncc(NCCOC)n2)cc1 |
| InChI | InChI=1S/C15H19N5O3/c1-3-23-14(21)11-4-6-12(7-5-11)18-15-19-13(10-17-20-15)16-8-9-22-2/h4-7,10H,3,8-9H2,1-2H3,(H2,16,18,19,20) |
| InChIKey | OMCKXSUOZWDHIW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|