C21H29N5O2 — CID 112943156
3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112943156) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943156 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-5-N-[2-(3,4-dimethoxyphenyl)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(CCNc2cnnc(NCCC3=CCCCC3)n2)cc1OC |
| InChI | InChI=1S/C21H29N5O2/c1-27-18-9-8-17(14-19(18)28-2)11-12-22-20-15-24-26-21(25-20)23-13-10-16-6-4-3-5-7-16/h6,8-9,14-15H,3-5,7,10-13H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | XNOZMCTVIDHPBY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|