C23H32N4O2 — CID 112869368
4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylpyrimidine-4,6-diamine (PubChem CID 112869368) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112869368 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylpyrimidine-4,6-diamine |
| SMILES | COc1ccc(CCNc2cc(NCCC3=CCCCC3)nc(C)n2)cc1OC |
| InChI | InChI=1S/C23H32N4O2/c1-17-26-22(24-13-11-18-7-5-4-6-8-18)16-23(27-17)25-14-12-19-9-10-20(28-2)21(15-19)29-3/h7,9-10,15-16H,4-6,8,11-14H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | NMCZWQCZMZBSAO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|