C21H28N4O — CID 112869410
6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(2-ethoxyphenyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112869410) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(2-ethoxyphenyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(2-ethoxyphenyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112869410 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(2-ethoxyphenyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | CCOc1ccccc1Nc1cc(NCCC2=CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C21H28N4O/c1-3-26-19-12-8-7-11-18(19)25-21-15-20(23-16(2)24-21)22-14-13-17-9-5-4-6-10-17/h7-9,11-12,15H,3-6,10,13-14H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | SVQWEUVCEJXKDS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|