C19H23FN4 — CID 112869429
6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(3-fluorophenyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112869429) has the molecular formula C19H23FN4 and a molecular weight of 326.42 g/mol. Its IUPAC name is 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(3-fluorophenyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(3-fluorophenyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112869429 |
| Molecular Formula | C19H23FN4 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(3-fluorophenyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCCC2=CCCCC2)cc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C19H23FN4/c1-14-22-18(21-11-10-15-6-3-2-4-7-15)13-19(23-14)24-17-9-5-8-16(20)12-17/h5-6,8-9,12-13H,2-4,7,10-11H2,1H3,(H2,21,22,23,24) |
| InChIKey | VMMICMQUMCYKCK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|