C20H24N4O — CID 112856617
1-[3-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112856617) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[3-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112856617 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[3-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2cc(NCCC3=CCCCC3)ncn2)c1 |
| InChI | InChI=1S/C20H24N4O/c1-15(25)17-8-5-9-18(12-17)24-20-13-19(22-14-23-20)21-11-10-16-6-3-2-4-7-16/h5-6,8-9,12-14H,2-4,7,10-11H2,1H3,(H2,21,22,23,24) |
| InChIKey | MYLGLDVQOVPRCU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|