C19H21N5 — CID 112856641
2-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112856641) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112856641 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[[6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1cc(NCCC2=CCCCC2)ncn1 |
| InChI | InChI=1S/C19H21N5/c20-13-16-8-4-5-9-17(16)24-19-12-18(22-14-23-19)21-11-10-15-6-2-1-3-7-15/h4-6,8-9,12,14H,1-3,7,10-11H2,(H2,21,22,23,24) |
| InChIKey | QADZKTNIKLBKAO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|