C19H21FN4O — CID 109342577
6-[2-(cyclohexen-1-yl)ethylamino]-N-(2-fluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109342577) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 6-[2-(cyclohexen-1-yl)ethylamino]-N-(2-fluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N-(2-fluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109342577 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 6-[2-(cyclohexen-1-yl)ethylamino]-N-(2-fluorophenyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1cc(NCCC2=CCCCC2)ncn1 |
| InChI | InChI=1S/C19H21FN4O/c20-15-8-4-5-9-16(15)24-19(25)17-12-18(23-13-22-17)21-11-10-14-6-2-1-3-7-14/h4-6,8-9,12-13H,1-3,7,10-11H2,(H,24,25)(H,21,22,23) |
| InChIKey | JRHAFCARHCEFRD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|