C21H22FN3O2 — CID 109095616
2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109095616) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095616 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-fluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cccc(C(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C21H22FN3O2/c22-16-9-4-5-10-17(16)25-21(27)19-12-6-11-18(24-19)20(26)23-14-13-15-7-2-1-3-8-15/h4-7,9-12H,1-3,8,13-14H2,(H,23,26)(H,25,27) |
| InChIKey | HJRYDFUZSKCJGY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|