C23H27N3O2 — CID 109095612
2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2,3-dimethylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109095612) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2,3-dimethylphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2,3-dimethylphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095612 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2,3-dimethylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(C(=O)NCCC3=CCCCC3)n2)c1C |
| InChI | InChI=1S/C23H27N3O2/c1-16-8-6-11-19(17(16)2)26-23(28)21-13-7-12-20(25-21)22(27)24-15-14-18-9-4-3-5-10-18/h6-9,11-13H,3-5,10,14-15H2,1-2H3,(H,24,27)(H,26,28) |
| InChIKey | YJFZVIJESKRDOW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|