C21H28N2O2 — CID 109132821
2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109132821) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132821 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2CC2C(=O)NCCC2=CCCCC2)c1C |
| InChI | InChI=1S/C21H28N2O2/c1-14-7-6-10-19(15(14)2)23-21(25)18-13-17(18)20(24)22-12-11-16-8-4-3-5-9-16/h6-8,10,17-18H,3-5,9,11-13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | LZLDBIOFKBQACK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|