C21H32N2O2 — CID 109132739
1-N,2-N-bis[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109132739) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-N,2-N-bis[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132739 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1-N,2-N-bis[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CC1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H32N2O2/c24-20(22-13-11-16-7-3-1-4-8-16)18-15-19(18)21(25)23-14-12-17-9-5-2-6-10-17/h7,9,18-19H,1-6,8,10-15H2,(H,22,24)(H,23,25) |
| InChIKey | CQOBMTYGQBKNNR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|